ID | 1505 |
Name | Beta-erythroidine |
Pubchem ID | 10074 |
KEGG ID | C06532 |
Source | Erythrina variegata |
Type | Natural |
Function | Neuromuscular blocking agent |
Drug Like Properties | Yes |
Molecular Weight | 273.33 |
Exact mass | 273.136493 |
Molecular formula | C16H19NO3 |
XlogP | -0.2 |
Topological Polar Surface Area | 38.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 1 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1CC23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
Isomeric SMILE | CO[C@@H]1C[C@]23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
Drugpedia | wiki |
References | 1. Ghosal,Aust. J. Chem.,24,(1971),2733 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |
ID | 1514 |
Name | Beta-erythroidine |
Pubchem ID | 10074 |
KEGG ID | C06532 |
Source | Erythrina variegata |
Type | Natural |
Function | Ganglionic blocking agent |
Drug Like Properties | Yes |
Molecular Weight | 273.33 |
Exact mass | 273.136493 |
Molecular formula | C16H19NO3 |
XlogP | -0.2 |
Topological Polar Surface Area | 38.8 |
H-Bond Donor | 0 |
H-Bond Acceptor | 4 |
Rotational Bond Count | 1 |
IUPAC Name | N/A |
Structure | |
SDF file | |
MOL file | |
PDB file | |
Canonical SMILE | COC1CC23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
Isomeric SMILE | CO[C@@H]1C[C@]23C4=C(CCN2CC=C3C=C1)COC(=O)C4 |
Drugpedia | wiki |
References | 1. Ghosal,Aust. J. Chem.,24,(1971),2733 2. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 3. Source 4. Function 5. All Records |